|
|
| | PRAZEPAM-D5 Basic information |
| Product Name: | PRAZEPAM-D5 | | Synonyms: | PRAZEPAM-D5;2H-1,4-Benzodiazepin-2-one, 7-chloro-1-(cyclopropylmethyl)-1,3-dihydro-5-(phenyl-d5)-;PRAZEPAM-D5,100/MLINMETHANOL;Prazepam-d5 solution;7-chloro-1-(cyclopropylmethyl)-5-(2,3,4,5,6-pentadeuteriophenyl)-3H-1,4-benzodiazepin-2-one;PRAZEPAM (D5, 98%) 100 UG/ML IN METHANOL;Prazepam-d5 (100 μg/mL in Methanol);Prazepam-d5 solution | | CAS: | 152477-89-9 | | MF: | C19H12ClD5N2O | | MW: | 329.83 | | EINECS: | 200-659-6 | | Product Categories: | | | Mol File: | 152477-89-9.mol |  |
| | PRAZEPAM-D5 Chemical Properties |
| Fp | 9℃ | | storage temp. | -20°C | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Off-White to Pale Yellow | | Major Application | clinical testing | | InChI | 1S/C19H17ClN2O/c20-15-8-9-17-16(10-15)19(14-4-2-1-3-5-14)21-11-18(23)22(17)12-13-6-7-13/h1-5,8-10,13H,6-7,11-12H2/i1D,2D,3D,4D,5D | | InChIKey | MWQCHHACWWAQLJ-RALIUCGRSA-N | | SMILES | O=C1CN=C(C(C=C(Cl)C=C2)=C2N1CC3CC3)C4=C([2H])C([2H])=C([2H])C([2H])=C4[2H] |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | PRAZEPAM-D5 Usage And Synthesis |
| Uses | Prazepam-d5, is the labeled analogue of Prazepam (P702250), a benzodiazepine derivative drug having anxiolytic, anticonvulsant, sedative and skeletal muscle relaxant properties. |
| | PRAZEPAM-D5 Preparation Products And Raw materials |
|