|
|
| | NORDIAZEPAM-D5 Basic information |
| | NORDIAZEPAM-D5 Chemical Properties |
| Melting point | 214-217°C | | Fp | 11 °C | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | A neat solid | | Major Application | clinical testing | | InChI | 1S/C15H11ClN2O/c16-11-6-7-13-12(8-11)15(17-9-14(19)18-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19)/i1D,2D,3D,4D,5D | | InChIKey | AKPLHCDWDRPJGD-RALIUCGRSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C2=NCC(=O)Nc3ccc(Cl)cc23 |
| Hazard Codes | Xn,T,F | | Risk Statements | 22-39/23/24/25-23/24/25-11 | | Safety Statements | 36-45-36/37-16-7 | | RIDADR | UN 1230 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | NORDIAZEPAM-D5 Usage And Synthesis |
| Chemical Properties | Beige Solid | | Uses | The primary labelled metabolite of Diazepam. A ligand for the GABAA receptor benzodiazepine modulatory site. Anxiolytic.
Controlled substance (depressant). |
| | NORDIAZEPAM-D5 Preparation Products And Raw materials |
|