|
|
| | DIAZEPAM-D5 Basic information |
| | DIAZEPAM-D5 Chemical Properties |
| Melting point | 131.5-134.5°C | | Boiling point | 497.380±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.261±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 9℃ | | storage temp. | 2-8°C | | solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | A neat solid | | pka | 3.398±0.10(predicted) | | Major Application | clinical testing | | InChI | 1S/C16H13ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h2-9H,10H2,1H3/i2D,3D,4D,5D,6D | | InChIKey | AAOVKJBEBIDNHE-VIQYUKPQSA-N | | SMILES | O=C1CN=C(C2=C([2H])C([2H])=C([2H])C([2H])=C2[2H])C3=C(C=CC(Cl)=C3)N1C | | EPA Substance Registry System | 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-(phenyl-2,3,4,5,6-d5)- (65854-76-4) |
| | DIAZEPAM-D5 Usage And Synthesis |
| Chemical Properties | Light Yellow Crystalline Solid | | Uses | Anxiolitic; muscle relaxant (skeletal); anticonvulsant.
Controlled substance (depressant) | | Uses | Labelled Diazepam, an anxiolytic; muscle relaxant (skeletal); anticonvulsant.
Diazepam is a Controlled substance (depressant). | | General Description | Diazepam is a benzodiazepine used to treat a number of symptoms from anxiety and panic attacks to insomnia. This stable-labeled internal standard is suited for quantitation of diazepam levels in urine, serum, or plasma by LC/MS or GC/MS for urine drug testing, clinical toxicology, forensic analysis, or isotope dilution methods. Diazepam, a benzodiazpine frequently abused recreationally, is sold under the trade name Valium. |
| | DIAZEPAM-D5 Preparation Products And Raw materials |
|