|
|
| | 2-CHLORO-6-FLUOROBENZYLAMINE Basic information |
| | 2-CHLORO-6-FLUOROBENZYLAMINE Chemical Properties |
| Boiling point | 91-93 °C/20 mmHg (lit.) | | density | 1.24 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.539 | | Fp | 82 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Liquid | | pka | 8.09±0.10(Predicted) | | color | Clear colorless to light yellow | | Sensitive | Air Sensitive | | BRN | 2357724 | | InChI | InChI=1S/C7H7ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2 | | InChIKey | GVULSXIBCHPJEH-UHFFFAOYSA-N | | SMILES | C1(CN)=C(F)C=CC=C1Cl | | CAS DataBase Reference | 15205-15-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-CHLORO-6-FLUOROBENZYLAMINE Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid |
| | 2-CHLORO-6-FLUOROBENZYLAMINE Preparation Products And Raw materials |
|