|
|
| | 2-Fluoro-6-Chlorobenzonitrile Basic information | | Synthesis |
| | 2-Fluoro-6-Chlorobenzonitrile Chemical Properties |
| Melting point | 55-59 °C(lit.) | | Boiling point | 104 °C11 mm Hg(lit.) | | density | 1.3760 (estimate) | | Fp | 104-105°C/11mm | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | powder to crystal | | color | White to Light yellow | | BRN | 1940332 | | InChI | InChI=1S/C7H3ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H | | InChIKey | XPTAYRHLHAFUOS-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(F)C=CC=C1Cl | | CAS DataBase Reference | 668-45-1(CAS DataBase Reference) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36/37/39-36 | | RIDADR | UN 3439 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Fluoro-6-Chlorobenzonitrile Usage And Synthesis |
| Synthesis | A further example of nitro rather than chloro acting as a leaving group is demonstrated in
the reaction of Ph4PHF2 with 2-chloro-6-nitrobenzonitrile to give 2-fluoro-6-
chlorobenzonitrile.
 | | Chemical Properties | colourless to light beige crystals, crystalline | | Uses | 2-Chloro-6-fluorobenzonitrile was used in the synthesis of:
- rac-2-chloro-6-(oxiran-2-ylmethoxy)benzonitrile
- high-molecular-weight, soluble polyarylether alternating copolymers containing pendent cyano groups
| | General Description | 2-Chloro-6-fluorobenzonitrile is an inhibitor of cellulose synthesis. | | Toxics Screening Level | The ITSL for chlorofluoro benzonitrile is 0.1 μg/m3 based on an annual averaging time. |
| | 2-Fluoro-6-Chlorobenzonitrile Preparation Products And Raw materials |
|