2-Propenamide, 2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-, (2E)- manufacturers
|
| | 2-Propenamide, 2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-, (2E)- Basic information |
| Product Name: | 2-Propenamide, 2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-, (2E)- | | Synonyms: | 2-Propenamide, 2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-, (2E)-;Entacapone Impurity 71;(E)-2-Cyano-3-(3,4-dihydroxyphenyl)-N,N-diethylacrylamide;Denitroentacapone;Entacapone Impurity K | | CAS: | 1217439-96-7 | | MF: | C14H16N2O3 | | MW: | 260.29 | | EINECS: | | | Product Categories: | | | Mol File: | 1217439-96-7.mol |  |
| | 2-Propenamide, 2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-, (2E)- Chemical Properties |
| Boiling point | 509.6±50.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | pka | 8.85±0.10(Predicted) | | InChI | InChI=1S/C14H16N2O3/c1-3-16(4-2)14(19)11(9-15)7-10-5-6-12(17)13(18)8-10/h5-8,17-18H,3-4H2,1-2H3/b11-7+ | | InChIKey | IACDFFVLQMLTIW-YRNVUSSQSA-N | | SMILES | C(N(CC)CC)(=O)/C(/C#N)=C/C1=CC=C(O)C(O)=C1 |
| | 2-Propenamide, 2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-, (2E)- Usage And Synthesis |
| Uses | (2E)-2-Cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-2-propenamide is considered to be an anti-influenza component towards A H1N1 virus. |
| | 2-Propenamide, 2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-, (2E)- Preparation Products And Raw materials |
|