- Entacapone acid
-
- $68.00
-
2026-07-27
- CAS:160391-70-8
- Purity: 99.76%
- Supply Ability: 10g
|
| | TYRPHOSTIN AG 1290 Basic information |
| Product Name: | TYRPHOSTIN AG 1290 | | Synonyms: | (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid;Entacapone Impurity 6(Entacapone EP Impurity F);TYRPHOSTIN AG 1290;Entacapone acid;XDDDOLQEZBJWFZ-LZCJLJQNSA-N;Entacapone impurity F;Entacapone Impurity 22(Entacapone EP Impurity F);(2E)-2-Cyano-3-(3,4-dihydroxy-5-nit | | CAS: | 160391-70-8 | | MF: | C10H6N2O6 | | MW: | 250.16 | | EINECS: | | | Product Categories: | | | Mol File: | 160391-70-8.mol |  |
| | TYRPHOSTIN AG 1290 Chemical Properties |
| Melting point | 124-126 °C | | Boiling point | 478.9±45.0 °C(Predicted) | | density | 1.744±0.06 g/cm3(Predicted) | | form | Yellow to green solid. | | pka | 0.51±0.10(Predicted) | | InChI | InChI=1S/C10H6N2O6/c11-4-6(10(15)16)1-5-2-7(12(17)18)9(14)8(13)3-5/h1-3,13-14H,(H,15,16)/b6-1+ | | InChIKey | XDDDOLQEZBJWFZ-LZCJLJQNSA-N | | SMILES | C(O)(=O)/C(/C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1 |
| | TYRPHOSTIN AG 1290 Usage And Synthesis |
| Uses | Entacapone Acid, is the acid derivative of Entacapone (E558500). (E)-Isomer of Entacapone polymorphic form A. Peripherally acting inhibitor of catechol-O-methyl transferase (COMT), an enzyme involved in the metabolism of catecholamine neurotransmitters and related drugs. Antiparkinsonian. |
| | TYRPHOSTIN AG 1290 Preparation Products And Raw materials |
|