- 3,5-Dinitrocatechol
-
- $32.00 / 5mg
-
2026-03-13
- CAS:7659-29-2
- Min. Order:
- Purity: 99.88%
- Supply Ability: 10g
|
| | 3,5-DINITROCATECHOL Basic information |
| Product Name: | 3,5-DINITROCATECHOL | | Synonyms: | 3,5-DINITROCATECHOL;3,5-DINITRO-1,2-BENZENEDIOL;Entacapone Impurity 5（Entacapone EP Impurity E）;
Imp. E (EP):3,5-Dinitrobenzene-1,2-diol;3,5-dinitro-2-benzenediol;3,5-dinitropyrocatechol;OR-486;3,5-DINITROCATECHOL (OR-486) (SELECTIVE INHIBITOR OF CATECHOL | | CAS: | 7659-29-2 | | MF: | C6H4N2O6 | | MW: | 200.11 | | EINECS: | | | Product Categories: | ALCOHOL | | Mol File: | 7659-29-2.mol |  |
| | 3,5-DINITROCATECHOL Chemical Properties |
| Melting point | 166-166.5℃ | | Boiling point | 354.5±42.0 °C(Predicted) | | density | 1.819±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | H2O: 0.17 mg/mL Solutions may be stored for several days at 4 °C., slightly soluble | | form | solid | | pka | 3.85±0.44(Predicted) | | color | yellow | | biological source | synthetic (organic) | | Water Solubility | H2O: slightly soluble 0.17mg/mL
45% (w/v) aq 2-hydroxypropyl-β-cyclodextrin: 2.8mg/mL
0.1 M HCl: slightly soluble
DMSO: soluble
aqueous buffer pH > 5: soluble
ethanol: soluble | | InChI | 1S/C6H4N2O6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,9-10H | | InChIKey | VDCDWNDTNSWDFJ-UHFFFAOYSA-N | | SMILES | Oc1cc(cc(c1O)[N+]([O-])=O)[N+]([O-])=O |
| WGK Germany | 3 | | RTECS | CZ8947010 | | Storage Class | 11 - Combustible Solids |
| | 3,5-DINITROCATECHOL Usage And Synthesis |
| Uses | OR 486 is an anti-inflammatory agent used in the treatment of rheumatoid arthritis and osteoarthritis. Entacapone (E588500) impurity. | | Biological Activity | Potent and selective inhibitor of catechol-O-methyl-transferase. | | storage | Store at RT |
| | 3,5-DINITROCATECHOL Preparation Products And Raw materials |
|