|
|
| | Sodium prop-2-yne-1-sulfonate Basic information |
| Product Name: | Sodium prop-2-yne-1-sulfonate | | Synonyms: | Propargyl sulfonate;Propynesulfonicacidsodiumsalt;2-Propyne-1-sulfonic acid sodium salt;sodium 2-propyne-1-sulphonate;Sodium propynesulfonate;(1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(1R,2E,4S)-4-(Cyclopropyl-d4)-4-hydroxy-1-Methyl-2-buten-1-yl]octahydro-7a-Methyl-4H-inden-4-ylidene]ethylidene]-4-Methylene-1,3-cyclohexanediol;Calciptriol-d4;Daivonex-d4 | | CAS: | 55947-46-1 | | MF: | C3H3NaO3S | | MW: | 142.11 | | EINECS: | 259-915-0 | | Product Categories: | | | Mol File: | 55947-46-1.mol |  |
| | Sodium prop-2-yne-1-sulfonate Chemical Properties |
| Melting point | 220 °C (decomp)(Solv: methanol (67-56-1)) | | Boiling point | 259.16℃[at 101 325 Pa] | | density | 1.04 g/mL at 25 °C | | vapor pressure | 0Pa at 25℃ | | Fp | 26 °C | | storage temp. | Inert atmosphere,2-8°C | | Appearance | Colorless to light yellow Liquid | | Water Solubility | 19.904g/L at 25℃ | | InChI | InChI=1S/C3H4O3S.Na/c1-2-3-7(4,5)6;/h1H,3H2,(H,4,5,6);/q;+1/p-1 | | InChIKey | LDHXNOAOCJXPAH-UHFFFAOYSA-M | | SMILES | S(CC#C)(=O)(=O)[O-].[Na+] | | LogP | -2.17 | | CAS DataBase Reference | 55947-46-1(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propyne-1-sulfonic acid, sodium salt (55947-46-1) |
| | Sodium prop-2-yne-1-sulfonate Usage And Synthesis |
| Uses | Sodium prop-2-yne-1-sulfonate has a variety of uses, primarily as an organic synthetic material and as an experimental buffer. It is also used in the preparation of a complex nickel plating solution. In bright nickel plating, it is an auxiliary alignment agent, which improves the brightness and filler of the lower zones, with obvious effects and less brittle plating. In addition, the compound is useful in various biochemical and physiological studies due to its ability to bind to proteins and other molecules. | | Flammability and Explosibility | Non flammable |
| | Sodium prop-2-yne-1-sulfonate Preparation Products And Raw materials |
|