|
|
| | (+/-)-10-CAMPHORSULFONIC ACID SODIUM SALT Basic information | | Application |
| Product Name: | (+/-)-10-CAMPHORSULFONIC ACID SODIUM SALT | | Synonyms: | SODIUM DL-10-CAMPHORSULFONATE;7,7-dimethyl-2-oxo-,sodiumsalt,(±)-Biscyclo[2.2.1.]heptane-1-methanesulfonicacid;bicyclo[2.2.1]heptane-1-methanesulfonicacid,7,7-dimethyl-2-oxo-,sodiumsalt,;Camphor-10-sulfonicacidsodiumsalt;Camphorsulfonicacidsodiumsalt;Camphor sulfonic acid sodium;Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, sodium salt (1:1);Sodiumcamphorsulfonate | | CAS: | 34850-66-3 | | MF: | C10H17NaO4S | | MW: | 256.29 | | EINECS: | 252-250-7 | | Product Categories: | Pharmaceutical Intermediates;Bicyclic Monoterpenes;Biochemistry;Terpenes | | Mol File: | 34850-66-3.mol |  |
| | (+/-)-10-CAMPHORSULFONIC ACID SODIUM SALT Chemical Properties |
| Melting point | 286-288 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Amorphous Powder | | color | White | | Water Solubility | almost transparency | | InChI | InChI=1S/C10H16O4S.Na.H/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;;/h7H,3-6H2,1-2H3,(H,12,13,14);; | | InChIKey | WOTUWWREIIPUPV-UHFFFAOYSA-N | | SMILES | C(C12CCC(CC1=O)C2(C)C)S(O)(=O)=O.[NaH] | | CAS DataBase Reference | 34850-66-3(CAS DataBase Reference) | | EPA Substance Registry System | Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, sodium salt (34850-66-3) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29147000 |
| | (+/-)-10-CAMPHORSULFONIC ACID SODIUM SALT Usage And Synthesis |
| Application | It has both direct and indirect stimulating effects on the medullary respiratory center and cerebral cortex, and also has a cardiotonic effect. It is used to treat acute heart failure, central nervous system depressant poisoning, and respiratory and circulatory depression caused by pneumonia, etc. This product is rapidly absorbed and is suitable for emergency treatment. | | Chemical Properties | white amorphous powder |
| | (+/-)-10-CAMPHORSULFONIC ACID SODIUM SALT Preparation Products And Raw materials |
|