|
|
| | Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate Basic information |
| Product Name: | Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate | | Synonyms: | n-[[5-(methylamino)-2-thienyl]carbonyl]-l-glutamic acid diethyl ester;diethyl n-[5-methylamino-2-thenoyl]-l-glutamate;(S)-Diethyl 2-(5-(MethylaMino)thiophene-2-carboxaMido)pentanedioate;L-Glutamic acid, N-[[5-(methylamino)-2-thienyl]carbonyl]-, 1,5-diethyl ester;iethyl(2S)-2-[[5-(methylamino)thiophene-2-carbonyl]amino]pentanedioate;Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate USP/EP/BP;Raltitrexed Impurity 24;Raltitrexed F | | CAS: | 112889-02-8 | | MF: | C15H22N2O5S | | MW: | 342.41 | | EINECS: | | | Product Categories: | Raltitrexed | | Mol File: | 112889-02-8.mol | ![Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate Structure](CAS/GIF/112889-02-8.gif) |
| | Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate Chemical Properties |
| Boiling point | 519.6±50.0 °C(Predicted) | | density | 1.231 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 12.89±0.46(Predicted) | | Appearance | Brown to reddish brown Oil | | InChI | InChI=1S/C15H22N2O5S/c1-4-21-13(18)9-6-10(15(20)22-5-2)17-14(19)11-7-8-12(16-3)23-11/h7-8,10,16H,4-6,9H2,1-3H3,(H,17,19)/t10-/m0/s1 | | InChIKey | OIUDYHGOODXYDK-JTQLQIEISA-N | | SMILES | C(OCC)(=O)[C@H](CCC(OCC)=O)NC(C1SC(NC)=CC=1)=O |
| | Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate Usage And Synthesis |
| Uses | N-[[5-(Methylamino)-2-thienyl]carbonyl]-L-glutamic Acid Diethyl Ester can be used as reactant/reagent for synthetic preparation of Raltitrexed (anticancer agent). An intermediate or impurity in the synthesis of Raltitrexed (R100500). Raltitrexed (R100500) is folate-based inhibitor of thymidylate synthase; rapidly and extensively metabolized to its more potent polyglutamate derivatives. Antineoplastic. |
| | Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate Preparation Products And Raw materials |
|