- Quillaic acid
-
-
2026-05-22
- CAS:631-01-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000 kg
- Quillaic Acid
-
- $70.00
-
2026-05-21
- CAS:631-01-6
- Purity: 98.36%
- Supply Ability: 10g
- Quillaic acid 631-01-6
-
- $30.00
-
2022-02-14
- CAS:631-01-6
- Min. Order: 20mg
- Purity: ≥98%
- Supply Ability: 1000.00 kgs
|
| | Quillaic acid Basic information |
| Product Name: | Quillaic acid | | Synonyms: | Quillaic acid 631-01-6;Quillaic acid(Quillaja sapogenin);quillaic acid, HPLC≥98%;Saponin bark extract;(3beta,4alpha,16alpha)-3,16-dihydroxy-23-oxoolean-12-en-28-oic acid;Quillaja sapogenin;Quillaja Saponaria Extract;Olean-12-en-28-oic acid, 3,16-dihydroxy-23-oxo-, (3.beta.,4.alpha.,16.alpha.)- | | CAS: | 631-01-6 | | MF: | C30H46O5 | | MW: | 486.68 | | EINECS: | 211-149-8 | | Product Categories: | | | Mol File: | 631-01-6.mol |  |
| | Quillaic acid Chemical Properties |
| Melting point | 294℃ | | alpha | D20 +56.1° (c = 2.9 in pyridine) | | Boiling point | 502.54°C (rough estimate) | | density | 1.0220 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly), Pyridine (Slightly) | | form | Solid | | pka | 4.41±0.70(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | MQUFAARYGOUYEV-RMRVVFRMNA-N | | SMILES | [C@@H]1(O)[C@@](C2[C@](C)(CC1)[C@]1([H])[C@@]([C@]3(C(=CC1)[C@@]1([C@@](CCC(C1)(C)C)(C(O)=O)[C@H](O)C3)[H])C)(C)CC2)(C)C=O |&1:0,2,4,8,10,11,15,16,26,r| | | CAS DataBase Reference | 631-01-6 |
| | Quillaic acid Usage And Synthesis |
| Uses | Quillaic Acid an unglycosylated saponin from the Quillaja saponaria bark is used as a topical antiinflammatory. | | Definition | ChEBI: A pentacyclic triterpenoid that is olean-12-ene substituted by hydroxy groups at positions 3 and 16, an oxo group at position 23 and a carboxy group at position 28 (the 3beta,16alpha stereoisomer). |
| | Quillaic acid Preparation Products And Raw materials |
|