|
|
| | 1-Methyl-4-nitro-1H-indazole Basic information |
| Product Name: | 1-Methyl-4-nitro-1H-indazole | | Synonyms: | 1-Methyl-4-nitro-1H-indazole;1-Methyl-4-nitro-2H-Indazole;1-methyl-4-nitroindazole;4,9-dimethoxy-5-oxo-7-furo[3,2-g][1]benzopyrancarboxylic acid;1H-Indazole, 1-methyl-4-nitro- | | CAS: | 26120-43-4 | | MF: | C8H7N3O2 | | MW: | 177.16 | | EINECS: | | | Product Categories: | Indazoles | | Mol File: | 26120-43-4.mol |  |
| | 1-Methyl-4-nitro-1H-indazole Chemical Properties |
| Melting point | 141-142 | | Boiling point | 332.9±15.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | crystalline powder | | pka | -1.87±0.30(Predicted) | | color | Yellow | | InChI | InChI=1S/C8H7N3O2/c1-10-7-3-2-4-8(11(12)13)6(7)5-9-10/h2-5H,1H3 | | InChIKey | FGSQGIYFGWQTRE-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C([N+]([O-])=O)=CC=C2)C=N1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 1-Methyl-4-nitro-1H-indazole Usage And Synthesis |
| | 1-Methyl-4-nitro-1H-indazole Preparation Products And Raw materials |
|