| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | 1-Hexanol-13C6 Basic information |
| | 1-Hexanol-13C6 Chemical Properties |
| Melting point | -52 °C(lit.) | | Boiling point | 156.5 °C(lit.) | | density | 0.861 g/mL at 25 °C | | Fp | 60 °C | | InChI | 1S/C6H14O/c1-2-3-4-5-6-7/h7H,2-6H2,1H3/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | ZSIAUFGUXNUGDI-IDEBNGHGSA-N | | SMILES | [13CH3][13CH2][13CH2][13CH2][13CH2][13CH2]O |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | RIDADR | UN 2282 3/PG 3 | | WGK Germany | WGK 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Flam. Liq. 3 |
| | 1-Hexanol-13C6 Usage And Synthesis |
| | 1-Hexanol-13C6 Preparation Products And Raw materials |
|