|
|
| | 4-Chloro-1,8-naphthalic anhydride Basic information |
| Product Name: | 4-Chloro-1,8-naphthalic anhydride | | Synonyms: | 4-Chloronaphthalene-1,8-Naphthalic Anhydride;6-Chloro-1H,3H-benzo[de]isochromene-1,3-dione;6-chloro-1h,3h-naphtho(1,8-cd)pyran-1,3-dione;4-CHLORO-1 8-NAPHTHALIC ANHYDRIDE TECH;4-chloronaphthalicanhydride;8-chloro-3-oxatricyclo[7.3.1.0^{5,13}]trideca-1(13),5,7,9,11-pentaene-2,4-dione;6-Chlorobenzo[de]isochromene-1,3-dione;4-CHLORO-1,8-NAPHTHALENEDICARBOXYLIC ANHYDRIDE | | CAS: | 4053-08-1 | | MF: | C12H5ClO3 | | MW: | 232.62 | | EINECS: | 223-760-7 | | Product Categories: | Building Blocks;Carbonyl Compounds;Carboxylic Acid Anhydrides;Chemical Synthesis;Intermediates of Dyes and Pigments;Organic Building Blocks;API Intermediate | | Mol File: | 4053-08-1.mol |  |
| | 4-Chloro-1,8-naphthalic anhydride Chemical Properties |
| Melting point | 202-206 °C (dec.) | | Boiling point | 332.56°C (rough estimate) | | density | 1.3447 (rough estimate) | | refractive index | 1.4530 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Sparingly), Methanol (Slightly, Sonicated) | | form | Solid | | color | Off-White to Light Brown | | Water Solubility | Hydrolyzes in water. | | Sensitive | Moisture Sensitive | | BRN | 178072 | | InChI | InChI=1S/C12H5ClO3/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15/h1-5H | | InChIKey | UJEUBSWHCGDJQU-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)C2=CC=C(Cl)C3=C2C1=CC=C3 | | CAS DataBase Reference | 4053-08-1(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Chloro-1,8-naphthalic anhydride(4053-08-1) | | EPA Substance Registry System | 4-Chloronapthalic anhydride (4053-08-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 2 | | RTECS | QL6127295 | | TSCA | TSCA listed | | HS Code | 29322985 |
| | 4-Chloro-1,8-naphthalic anhydride Usage And Synthesis |
| Chemical Properties | beige to brown powder | | Uses | 4-Chloro-1,8-naphthalic anhydride is used in dyes and pigments. It is also used in agrochemical, pharmaceutical. |
| | 4-Chloro-1,8-naphthalic anhydride Preparation Products And Raw materials |
|