3-Amino-6-chloro-4,5-dimethylpyridazine manufacturers
|
| | 3-Amino-6-chloro-4,5-dimethylpyridazine Basic information | | Uses |
| Product Name: | 3-Amino-6-chloro-4,5-dimethylpyridazine | | Synonyms: | 6-Chloro-4,5-dimethylpyridazin-3-amine, 3-Amino-6-chloro-4,5-dimethyl-1,2-diazine;6-chloro-4,5-dimethyl-3-Pyridazinamine;3-Amino-6-chloro-4,5-dimethylpyridazine 95+%;3-Pyridazinamine, 6-chloro-4,5-dimethyl-;3-AMINO-6-CHLORO-4,5-DIMETHYLPYRIDAZINE ISO 9001:2015 REACH;3-Amino-6-chloro-4,5-dimethylpyridazine | | CAS: | 76593-36-7 | | MF: | C6H8ClN3 | | MW: | 157.6 | | EINECS: | | | Product Categories: | | | Mol File: | 76593-36-7.mol |  |
| | 3-Amino-6-chloro-4,5-dimethylpyridazine Chemical Properties |
| Melting point | 200-203°C | | Boiling point | 369.3±37.0 °C(Predicted) | | density | 1.284±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 5.41±0.10(Predicted) | | color | Light brown | | InChI | InChI=1S/C6H8ClN3/c1-3-4(2)6(8)10-9-5(3)7/h1-2H3,(H2,8,10) | | InChIKey | NYQKWJMDQIXMEE-UHFFFAOYSA-N | | SMILES | C1(N)=NN=C(Cl)C(C)=C1C |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 3-Amino-6-chloro-4,5-dimethylpyridazine Usage And Synthesis |
| Uses | 3-Amino-6-chloro-4,5-dimethylpyridazine (cas# 76593-36-7) is a useful research chemical. |
| | 3-Amino-6-chloro-4,5-dimethylpyridazine Preparation Products And Raw materials |
|