|
|
| | Bis(2-ethylhexyl)phthalate (ring-d4) Basic information |
| Product Name: | Bis(2-ethylhexyl)phthalate (ring-d4) | | Synonyms: | DI-2-ETHYLHEXYL PHTHALATE-D4;BIS(2-ETHYLHEXYL)PHTHALATE-3,4,5,6-D4;bis(2-ethylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate;Phthalic acid, bis-2-ethylhexyl ester D4;Bis(2-ethylhexyl) Phthalate-d4 Solution,100ppm;1,2-Benzenedicarboxylic Acid-d4 1,2-bis(2-ethylhexyl) Ester;Bis-Phthalate-d4;DEHP-3,4,5,6-d4 | | CAS: | 93951-87-2 | | MF: | C24H38O4 | | MW: | 390.56 | | EINECS: | | | Product Categories: | EstersFood&Beverage Standards;Analytical Standards;AromaticsAlphabetic;B;BI - BZAnalytical Standards;Chemical Class;Food Residue Analysis;Alphabetical Listings;Stable Isotopes;Aromatics;Isotope Labelled Compounds;PhthalatesAnalytical Standards;Plasticizers | | Mol File: | 93951-87-2.mol |  |
| | Bis(2-ethylhexyl)phthalate (ring-d4) Chemical Properties |
| Melting point | -50 °C(lit.) | | Boiling point | 231 °C5 mm Hg(lit.) | | density | 0.996 g/mL at 25 °C | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colourless | | Major Application | agriculture cleaning products cosmetics food and beverages personal care | | InChI | 1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3/i11D,12D,15D,16D | | InChIKey | BJQHLKABXJIVAM-SAQXESPHSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCC(CC)CCCC)c(c1[2H])C(=O)OCC(CC)CCCC | | EPA Substance Registry System | Bis(2-ethylhexyl) phthalate-d4 (93951-87-2) | | CAS Number Unlabeled | 117-81-7 |
| Hazard Codes | T | | Risk Statements | 60-61 | | Safety Statements | 53-45 | | WGK Germany | 1 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | Bis(2-ethylhexyl)phthalate (ring-d4) Usage And Synthesis |
| Uses | BIS(2-ETHYLHEXYL)PHTHALATE (RING-D4) is used to import softness and flexibility to PVC products. |
| | Bis(2-ethylhexyl)phthalate (ring-d4) Preparation Products And Raw materials |
|