DI-N-PENTYL PHTHALATE-D4 manufacturers
|
| | DI-N-PENTYL PHTHALATE-D4 Basic information |
| Product Name: | DI-N-PENTYL PHTHALATE-D4 | | Synonyms: | DI-N-PENTYL PHTHALATE-3,4,5,6-D4;Di-pentyl Phthalate-3,4,5,6-D4;Phthalic acid, bis-n-pentyl ester D4;Amyl Phthalate-d4;Di-n-pentyl Phthalate-3,4,5,6-d4 @100 μg/mL in Methanol;[2H4]-di-n-Pentyl Phthalate;Dipentyl phthalate-3,4,5,6-d4 Solution in Hexane, 100μg/mL;1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, dipentyl ester | | CAS: | 358730-89-9 | | MF: | C18H22D4O4 | | MW: | 310.42 | | EINECS: | | | Product Categories: | | | Mol File: | 358730-89-9.mol |  |
| | DI-N-PENTYL PHTHALATE-D4 Chemical Properties |
| Boiling point | 342 °C | | density | 1.036 g/mL at 25 °C | | Fp | 118 °C | | solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colorless to light yellow | | Major Application | cleaning products cosmetics environmental food and beverages personal care | | InChI | 1S/C18H26O4/c1-3-5-9-13-21-17(19)15-11-7-8-12-16(15)18(20)22-14-10-6-4-2/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3/i7D,8D,11D,12D | | InChIKey | IPKKHRVROFYTEK-CXRURWBMSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCCCCC)c(c1[2H])C(=O)OCCCCC |
| Hazard Codes | T,N | | Risk Statements | 60-61-50 | | Safety Statements | 53-45-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1 Repr. 1B |
| | DI-N-PENTYL PHTHALATE-D4 Usage And Synthesis |
| Uses | Amyl Phthalate-d4 is the isotope labelled analog of Amyl Phthalate. Amyl Phthalate, is a Phthalate esters (PEs) acting as a plasticizer compounds that are widely used for many consumer product applications. It is also known to induce male fetal endocrine toxicity and postnatal reproductive malformations by disrupting androgen production during the sexual differentiation period of development. |
| | DI-N-PENTYL PHTHALATE-D4 Preparation Products And Raw materials |
|