| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(R)-1,1-Diphenyl-2-aminopropane CAS:67659-36-3 Purity:97% Package:1g, 5g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(R)-(+)-1,1-Diphenyl-2-aMinopropane CAS:67659-36-3 Purity:97% Package:500MG
|
|
| | (R)-1,1-DIPHENYL-2-AMINOPROPANE
Basic information |
| Product Name: | (R)-1,1-DIPHENYL-2-AMINOPROPANE
| | Synonyms: | Benzeneethanamine, .alpha.-methyl-.beta.-phenyl-, (.alpha.R)-;Benzeneethanamine, α-methyl-β-phenyl-, (αR)-;(R)-1,1-Diphenylpropan-2-amine;(R)-(+)-1,1-Diphenyl-2-aminopropane | | CAS: | 67659-36-3 | | MF: | C15H17N | | MW: | 211.3 | | EINECS: | | | Product Categories: | | | Mol File: | 67659-36-3.mol |  |
| | (R)-1,1-DIPHENYL-2-AMINOPROPANE
Chemical Properties |
| Melting point | 77-80°C (lit.) | | Boiling point | 324.2±11.0 °C(Predicted) | | density | 1.022±0.06 g/cm3(Predicted) | | pka | 9.21±0.10(Predicted) | | Optical Rotation | [α]20/D +16°, c = 1 in chloroform | | InChI | 1S/C15H17N/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15H,16H2,1H3/t12-/m1/s1 | | InChIKey | XNKICCFGYSXSAI-GFCCVEGCSA-N | | SMILES | C[C@@H](N)C(c1ccccc1)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-1,1-DIPHENYL-2-AMINOPROPANE
Usage And Synthesis |
| Uses | (R)-(+)-1,1-Diphenyl-2-aminopropane can be used as a precursor for the preparation of trisubstituted dihydroisoquinoline derivatives via Bischler-Napieralski reaction. |
| | (R)-1,1-DIPHENYL-2-AMINOPROPANE
Preparation Products And Raw materials |
|