|
|
| | Ethylenediaminetetraacetic acid tetrasodium salt dihydrate Basic information |
| | Ethylenediaminetetraacetic acid tetrasodium salt dihydrate Chemical Properties |
| Melting point | >300°C | | Fp | 350°C | | storage temp. | room temp | | solubility | H2O: clear, colorless | | form | Liquid | | color | Yellow-Orange | | PH | 10.5-11.5 (50g/l, H2O, 20℃) | | Water Solubility | almost transparency | | BRN | 3861753 | | InChI | InChI=1S/C10H16N2O8.Na.H2O.H/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;1H2; | | InChIKey | LHCZUGDUAQREMU-UHFFFAOYSA-N | | SMILES | N(CC(=O)O)(CC(=O)O)CCN(CC(=O)O)CC(=O)O.[NaH].O | | CAS DataBase Reference | 10378-23-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-22 | | Safety Statements | 26-36/37-46-39 | | WGK Germany | 3 | | RTECS | DB6145180 | | TSCA | Yes | | HS Code | 29224995 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Dam. 1
STOT RE 2 |
| | Ethylenediaminetetraacetic acid tetrasodium salt dihydrate Usage And Synthesis |
| Chemical Properties | white crystals or powder | | Uses | Ethylenediaminetetraacetic acid tetrasodium salt dihydrate has been used:
- as a chelating agent to isolate human endometrial stem cell/stromal cells (hEnSCs) from menstrual blood
- as a chelator in animal and testicular cell isolation
- as a chelator for the culture of neural stem cells
| | Uses | Used to eliminate enzyme inhibition by traces of heavy metals, and to inhibit enzymes that require divalent cations as cofactors. | | General Description | Ethylenediaminetetraacetic acid (EDTA) is a chelator of metal ions. It is a substituted diamine, which has antibacterial activity. EDTA removes the undesirable effects of ferric, cupric and manganic ions in bleaching. It prevents cellular division, chlorophyll synthesis and algal biomass production. EDTA is an inhibitor of metalloprotease. It has anticoagulant property. | | reaction suitability | reagent type: chelator | | Biological Activity | Ethylenediaminetetraacetic acid (EDTA) is used to eliminate enzyme inhibition by traces of heavy metals, and to inhibit enzymes th at require divalent cations as cofactors.', 'Ethylenediaminetetraacetic acid (EDTA) is used to tre at patients poisoned with heavy metal ions. It functions as a chelator of the zinc ion in the active site of metalloproteases. EDTA inhibits other metal ion-dependent proteases such as calcium-dependent cysteine proteases. It might interfere with biological events which are metal ion-dependent. EDTA inhibits platelet aggregation and is the most preferred anticoagulant for platelet counts. It associates with other active agents to modulate microorganisms and biofilms, like citric acid, alcohol, antibiotics, polyhexamethylene biguanide (PHMB) quaternary ammonium compounds, and other antiseptics. EDTA is used as an anticoagulant for hematological testing, as it preserves the cellular components and morphology of blood cells. |
| | Ethylenediaminetetraacetic acid tetrasodium salt dihydrate Preparation Products And Raw materials |
|