|
|
| | 3,4-Diethoxy nitrobenzene Basic information |
| Product Name: | 3,4-Diethoxy nitrobenzene | | Synonyms: | 1,2-Diethoxy-4-nitrobenzene;Benzene, 1,2-diethoxy-4-nitro-;MFCD00186132;3,4-Diethoxynitrobenzene,1,2-diethoxy-4-nitrobenzene;3,4-Diethoxy nitrobenzene | | CAS: | 4992-63-6 | | MF: | C10H13NO4 | | MW: | 211.21 | | EINECS: | | | Product Categories: | | | Mol File: | 4992-63-6.mol |  |
| | 3,4-Diethoxy nitrobenzene Chemical Properties |
| Melting point | 75 °C | | Boiling point | 328.6±22.0 °C(Predicted) | | density | 1.158±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H13NO4/c1-3-14-9-6-5-8(11(12)13)7-10(9)15-4-2/h5-7H,3-4H2,1-2H3 | | InChIKey | DTYUTSMRCQYVNW-UHFFFAOYSA-N | | SMILES | C1(OCC)=CC=C([N+]([O-])=O)C=C1OCC |
| | 3,4-Diethoxy nitrobenzene Usage And Synthesis |
| Chemical Properties | 3,4-Diethoxy nitrobenzene is pale yellow needle crystal, mp72～73℃, insoluble in water, soluble in common organic solvents. | | Uses | 3,4-Diethoxy nitrobenzene is an intermediate of the fungicide etamocarb. | | Synthesis | O-diethoxybenzene reacts with solvent acetic acid, then adds nitric acid, and finally 3,4-Diethoxy nitrobenzene can be obtained. |
| | 3,4-Diethoxy nitrobenzene Preparation Products And Raw materials |
|