| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 2-Bromoadamantane
-
- $5.00
-
2026-04-10
- CAS:7314-85-4
- Min. Order: 1KG
- Purity: 99% hplc
- Supply Ability: 500TONS
|
| | 2-Bromoadamantane Basic information |
| | 2-Bromoadamantane Chemical Properties |
| Melting point | 138-140 °C(lit.) | | Boiling point | 248.79°C (rough estimate) | | density | 1.2686 (rough estimate) | | refractive index | 1.6411 (estimate) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to lump | | color | White to Almost white | | BRN | 4655839 | | InChI | 1S/C10H15Br/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2/t6-,7+,8-,9+,10 | | InChIKey | RCXJARRRXOPXBC-MGPGSJOLSA-N | | SMILES | BrC1[C@H]2C[C@@H]3C[C@H](C2)C[C@H]1C3 | | CAS DataBase Reference | 7314-85-4(CAS DataBase Reference) | | NIST Chemistry Reference | Tricyclo[3.3.1.13,7]decane, 2-bromo-(7314-85-4) |
| | 2-Bromoadamantane Usage And Synthesis |
| Chemical Properties | white adhering crystalline mass, chunks or powder | | Uses | 2-Bromoadamantane was used to study the c-alkylation of phenol. |
| | 2-Bromoadamantane Preparation Products And Raw materials |
|