| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Amino-4-chlorotoluene hydrochloride Basic information |
| Product Name: | 2-Amino-4-chlorotoluene hydrochloride | | Synonyms: | C.I.37090【base hydrochloride】;Benzenamine, 5-chloro-2-methyl-, hydrochloride;Benzenamine, 5-chloro-2-methyl-, hydrochloride (1:1);Einecs 228-403-9;2-Amino-4-chlorotoluene Hydrochloride
5-Chloro-o-toluidine Hydrochloride;5-CHLORO-O-TOLUIDINE HYDROCHLORIDE;5-CHLORO-2-METHYLANILINE HYDROCHLORIDE;5-chloro-2-methyl-benzenaminhydrochloride | | CAS: | 6259-42-3 | | MF: | C7H9Cl2N | | MW: | 178.06 | | EINECS: | 228-403-9 | | Product Categories: | Dyes and Pigments | | Mol File: | 6259-42-3.mol |  |
| | 2-Amino-4-chlorotoluene hydrochloride Chemical Properties |
| Melting point | 265-267 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | almost transparency in Methanol | | Colour Index | 37090 | | form | powder to crystal | | color | White to Light yellow to Light red | | InChI | InChI=1S/C7H8ClN.ClH/c1-5-2-3-6(8)4-7(5)9;/h2-4H,9H2,1H3;1H | | InChIKey | BMZGSMUCRXYUGB-UHFFFAOYSA-N | | SMILES | C1(N)C=C(C=CC=1C)Cl.Cl | | CAS DataBase Reference | 6259-42-3(CAS DataBase Reference) | | EPA Substance Registry System | 5-Chloro-2-methylaniline hydrochloride (6259-42-3) |
| | 2-Amino-4-chlorotoluene hydrochloride Usage And Synthesis |
| Chemical Properties | Grey-white powder, which becomes darker after storage. The pure product (free amine) has a melting point of 20-22 °C and a boiling point of 238.5 °C. Easily soluble in ethanol, ether and other organic solvents; soluble in hot water and evaporated with water vapor. | | Uses | 5-Chloro-2-methylaniline Hydrochloride is mainly used as a color developer for dyeing and printing of cotton, silk and nylon fiber fabrics, and can be used to prepare fast pigments. | | Synthesis | Using p-toluidine as raw material, 5-Chloro-2-methylaniline Hydrochloride is obtained by nitration, diazotization, chlorination, reduction, salt formation, and then filtration and drying. |
| | 2-Amino-4-chlorotoluene hydrochloride Preparation Products And Raw materials |
|