| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Chloro-2-nitrobenzyl chloride Basic information |
| Product Name: | 4-Chloro-2-nitrobenzyl chloride | | Synonyms: | ALPHA,4-DICHLORO-2-NITROTOLUENE;Benzene, 4-chloro-1-(chloromethyl)-2-nitro-;α,4-dichloro-2-nitrotoluene;a,4-Dichloro-2-nitrotoluene.;4-Chloro-2-nitrobenzyl chloride,98%;4-Chloro-2-nitrobenzyl chloridealpha,4-Dichloro-2-nitrotoluene;1-chloro-3-(chloromethyl)-5-nitrobenzene;1-chloro-3-(chloromethyl)-5-nitro-benzene | | CAS: | 938-71-6 | | MF: | C7H5Cl2NO2 | | MW: | 206.03 | | EINECS: | 213-345-9 | | Product Categories: | | | Mol File: | 938-71-6.mol |  |
| | 4-Chloro-2-nitrobenzyl chloride Chemical Properties |
| Melting point | 38-44 °C(lit.) | | Boiling point | 160-170 °C(Press: 11 Torr) | | density | 1.4062 (rough estimate) | | refractive index | 1.6100 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | InChI | 1S/C7H5Cl2NO2/c8-4-5-1-2-6(9)3-7(5)10(11)12/h1-3H,4H2 | | InChIKey | OMPHLGROCARZOU-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(Cl)ccc1CCl |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29049095 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| | 4-Chloro-2-nitrobenzyl chloride Usage And Synthesis |
| Chemical Properties | Pale yellow to tan low melting solid | | Uses | 4-Chloro-2-nitrobenzyl chloride has been used in the synthesis of 3-iodothyronamine. |
| | 4-Chloro-2-nitrobenzyl chloride Preparation Products And Raw materials |
|