| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,5-Difluoro-2-isopropoxyphenylboronic acid Basic information |
| | 4,5-Difluoro-2-isopropoxyphenylboronic acid Chemical Properties |
| Melting point | 75-79 °C | | storage temp. | Store at Room Tem. | | form | solid | | InChI | 1S/C9H11BF2O3/c1-5(2)15-9-4-8(12)7(11)3-6(9)10(13)14/h3-5,13-14H,1-2H3 | | InChIKey | RTEYYHDTNPHABZ-UHFFFAOYSA-N | | SMILES | CC(C)Oc1cc(F)c(F)cc1B(O)O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | UN 3335 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4,5-Difluoro-2-isopropoxyphenylboronic acid Usage And Synthesis |
| Uses | 4,5-Difluoro-2-isopropoxyphenylboronic acid is a derivative of boronic acid which can activate various DNA cross-linking agents |
| | 4,5-Difluoro-2-isopropoxyphenylboronic acid Preparation Products And Raw materials |
|