|
|
| | 6,7,15,16-Dimethylene-4-ene-3,17-androstenedione Basic information |
| Product Name: | 6,7,15,16-Dimethylene-4-ene-3,17-androstenedione | | Synonyms: | 1H-Dicyclopropa[6,7:15,16]cyclopenta[a]phenanthrene-3,17(2H,10H)-dione;17-Keto Drospirenone;Drospirenone Impurity 3(Drospirenone EP Impurity C);UNII-Q37FDQ515T;6,7,15,16-Dimethylene-4-ene-3,17-androstenedione;(6R,7R,8R,9S,10R,13S,14S,15S,16S)-6,7,8,9,11,12,13,14,15,16,20,21-Dodecahydro
-10,13-diMethyl-1H-dicyclopropa[6,7:15,16]cyclopenta[a]phenanthrene-3,17(2H,10H)-dione;Drospirenone EP Impurity C;6β,7β,15β,16β-DiMethylene-androst-4-ene-3,17-dione | | CAS: | 116298-21-6 | | MF: | C21H26O2 | | MW: | 310.43 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Steroids | | Mol File: | 116298-21-6.mol |  |
| | 6,7,15,16-Dimethylene-4-ene-3,17-androstenedione Chemical Properties |
| Boiling point | 462.358±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.22 | | solubility | Chloroform (Slightly), Methanol (Very Slightly),Water (Very Slightly) | | form | Solid | | color | White to Off-White | | InChIKey | VGUTUSVKXLWMPF-YWBSSBOONA-N | | SMILES | [C@@]12([H])C[C@]1([H])[C@]1([H])[C@]([H])(CC[C@]3(C)C(=O)[C@]4(C[C@@]4([H])[C@]31[H])[H])[C@@]1(C)CCC(=O)C=C21 |&1:0,3,5,7,11,15,17,19,22,r| |
| | 6,7,15,16-Dimethylene-4-ene-3,17-androstenedione Usage And Synthesis |
| Uses | An intermediate for the production of Drospirenone (D689500) from Androstenedione (A637550). |
| | 6,7,15,16-Dimethylene-4-ene-3,17-androstenedione Preparation Products And Raw materials |
|