| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- N-Acetyl-DL-methionine
-
- $1.50
-
2026-05-15
- CAS:1115-47-5
- Min. Order: 1g
- Purity: 98.0% Min
- Supply Ability: 100 Tons
|
| | N-Acetyl-DL-methionine Basic information |
| | N-Acetyl-DL-methionine Chemical Properties |
| Melting point | 117-119 °C(lit.) | | Boiling point | 453.6±40.0 °C(Predicted) | | density | 1.2684 (rough estimate) | | refractive index | 1.6370 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.50±0.10(Predicted) | | color | White to Off-White | | Water Solubility | Soluble in water, ethanol, ethyl acetate. | | Merck | 14,96 | | BRN | 1725554 | | Major Application | peptide synthesis | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 | | InChIKey | XUYPXLNMDZIRQH-LURJTMIESA-N | | SMILES | C(O)(=O)[C@H](CCSC)NC(C)=O | | CAS DataBase Reference | 1115-47-5(CAS DataBase Reference) | | EPA Substance Registry System | Methionine, N-acetyl- (1115-47-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | RTECS | PD0500000 | | TSCA | TSCA listed | | HS Code | 29309070 | | Storage Class | 11 - Combustible Solids |
| | N-Acetyl-DL-methionine Usage And Synthesis |
| Description | N-acetylmethionine is a methionine derivative that is methionine in which one of the amine hydrogens is substituted by an acetyl group.It is a conjugate acid of a N-acetylmethioninate. | | Chemical Properties | White crystalline powder | | Uses | N-Acetyl-DL-methionine is used as pharmaceutical intermediate, biochemical reagent. | | Definition | ChEBI: N-acetylmethionine is a methionine derivative that is methionine in which one of the amine hydrogens is substituted by an acetyl group. It is a N-acyl-amino acid, a methionine derivative, a methyl sulfide and a monocarboxylic acid. It is a conjugate acid of a N-acetylmethioninate. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Acetyl-DL-methionine Preparation Products And Raw materials |
|