|
|
| | Dimethyl octadecanedioate Basic information | | Uses |
| Product Name: | Dimethyl octadecanedioate | | Synonyms: | octadecanedioic acid,dimethyl ester;Octadecanedioic acid, 1,18-dimethyl ester;DimethylOctadecanedioate>Dimethy10ctadecanedioate;Dimethyl octadecanedioate | | CAS: | 1472-93-1 | | MF: | C20H38O4 | | MW: | 342.51 | | EINECS: | 604-582-2 | | Product Categories: | | | Mol File: | 1472-93-1.mol |  |
| | Dimethyl octadecanedioate Chemical Properties |
| Melting point | 60 °C | | Boiling point | 207 °C / 3mmHg | | density | 0.936±0.06 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 25℃ | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 616ng/L at 20℃ | | InChI | InChI=1S/C20H38O4/c1-23-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)24-2/h3-18H2,1-2H3 | | InChIKey | ZOXMHKCFDXHCJX-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCCCCCCCCCCCCC(OC)=O | | LogP | 7.56 | | EPA Substance Registry System | Octadecanedioic acid, 1,18-dimethyl ester (1472-93-1) |
| TSCA | TSCA listed | | HS Code | 2917.19.7050 |
| | Dimethyl octadecanedioate Usage And Synthesis |
| Uses | Dimethyl Octadecanedioate is used for preparation and demethylation and polymerization of self-metathesis of fatty acid methyl esters. | | Uses | Dimethyl Octadecanedioate is used for preparation and demethylation and polymerization of self-metathesis of fatty acid methyl esters. | | Flammability and Explosibility | Not classified |
| | Dimethyl octadecanedioate Preparation Products And Raw materials |
|