| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 4-(1,1,3,3-Tetramethylbutyl)phenol-13C6, 4-tert-OP-13C6 Basic information |
| Product Name: | 4-(1,1,3,3-Tetramethylbutyl)phenol-13C6, 4-tert-OP-13C6 | | Synonyms: | 4-(1,1,3,3-Tetramethylbutyl)phenol-13C6, 4-tert-OP-13C6;4-tert-Octylphenol-13C6 (ring-13C6) solution;4-tert-Octylphenol-ring-13C6 solution
;4-TERT-OCTYLPHENOL (RING-13C6, 99%) 100 UG/ML IN METHANOL;[13C6]-4-tert-Octylphenol;4-tert-Octylphenol-13C6 (10μg/mL in Acetone);4-tert-Octylphenol-13C6 (100μg/mL in Acetone);4-tert-Octylphenol-13C6 in acetone | | CAS: | 1173020-24-0 | | MF: | C14H22O | | MW: | 212.28 | | EINECS: | 688-191-2 | | Product Categories: | | | Mol File: | 1173020-24-0.mol |  |
| | 4-(1,1,3,3-Tetramethylbutyl)phenol-13C6, 4-tert-OP-13C6 Chemical Properties |
| density | 0.935±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | -17 °C | | storage temp. | −20°C | | solubility | Acetone (Soluble) | | form | Colourless Solution | | Major Application | environmental | | InChI | 1S/C14H22O/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11/h6-9,15H,10H2,1-5H3/i6+1,7+1,8+1,9+1,11+1,12+1 | | InChIKey | ISAVYTVYFVQUDY-UJYFPCGESA-N | | SMILES | O[13C]1=[13CH][13CH]=[13C](C(C)(C)CC(C)(C)C)[13CH]=[13CH]1 |
| Hazard Codes | F,Xi | | Risk Statements | 11-36-66-67 | | Safety Statements | 9-16-26 | | RIDADR | UN 1090 3/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| | 4-(1,1,3,3-Tetramethylbutyl)phenol-13C6, 4-tert-OP-13C6 Usage And Synthesis |
| Uses | 4-tert-Octylphenol-13C6 is a common environmental pollutant showing weak estrogenic effects. It has been shown to cause harm to the male reproductive system of vertebrates. |
| | 4-(1,1,3,3-Tetramethylbutyl)phenol-13C6, 4-tert-OP-13C6 Preparation Products And Raw materials |
|