|
|
| | Bis(4-methyl-2-pentyl)phthalate Basic information |
| | Bis(4-methyl-2-pentyl)phthalate Chemical Properties |
| Boiling point | 341.5±10.0 °C(Predicted) | | density | 1.010±0.06 g/cm3(Predicted) | | refractive index | n20/D 1.484-1.488 | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Major Application | environmental | | InChI | 1S/C20H30O4/c1-15(2)9-7-13-23-19(21)17-11-5-6-12-18(17)20(22)24-14-8-10-16(3)4/h5-6,11-12,15-16H,7-10,13-14H2,1-4H3 | | InChIKey | ALEROMXYYSQFLX-UHFFFAOYSA-N | | SMILES | O=C(OCCCC(C)C)C1=CC=CC=C1C(OCCCC(C)C)=O |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | Bis(4-methyl-2-pentyl)phthalate Usage And Synthesis |
| Uses | Bis(4-methyl-2-pentyl)phthalate, is a phthalic acid ester (PAEs), widely used in many consumable products with potential carcinogenic properties. It is also the product of the fermentation of Streptomyces regnesis 099. | | Uses | Bis(4-methylpentyl) Phthalate, is a phthalic acid ester (PAEs), widely used in many consumable products with potential carcinogenic properties. It is also the product of the fermentation of Streptomyces regnesis 099. |
| | Bis(4-methyl-2-pentyl)phthalate Preparation Products And Raw materials |
|