| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(Fmoc-hydrazino)-benzoic acid Basic information |
| | 4-(Fmoc-hydrazino)-benzoic acid Chemical Properties |
| density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.58±0.10(Predicted) | | BRN | 8082614 | | Major Application | peptide synthesis | | InChI | 1S/C22H18N2O4/c25-21(26)14-9-11-15(12-10-14)23-24-22(27)28-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20,23H,13H2,(H,24,27)(H,25,26) | | InChIKey | MLVJMSRGLQCZDE-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(NNC(=O)OCC2c3ccccc3-c4ccccc24)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29280000 | | Storage Class | 11 - Combustible Solids |
| | 4-(Fmoc-hydrazino)-benzoic acid Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis reagent type: linker |
| | 4-(Fmoc-hydrazino)-benzoic acid Preparation Products And Raw materials |
|