2'-Hydroxy-4',6'-dimethoxyacetophenone manufacturers
|
| | 2'-Hydroxy-4',6'-dimethoxyacetophenone Basic information |
| Product Name: | 2'-Hydroxy-4',6'-dimethoxyacetophenone | | Synonyms: | 6-HYDROXY-2,4-DIMETHOXYACETOPHENONE;4,6-DIMETHOXY-2-HYDROXYACETOPHENONE;Hydroxy-4',6'-diMethoxyaceto;2'-Hydroxy-4',6'-dimethoxyacetophenone 97%;JR-8967, 2'-Hydroxy-4',6'-dimethoxyacetophenone, 97%;1,4-dichloro-2-[2,5-dichloro-4-(methylthio)phenyl]-5-(methylthio)benzene;1-(2-Hydroxy-4,6-dimethoxyphenyl)ethan-1-on;2,4-DIMETHOXY-6-HYDROXYACETOPHENONE | | CAS: | 90-24-4 | | MF: | C10H12O4 | | MW: | 196.2 | | EINECS: | 201-978-3 | | Product Categories: | Inhibitors;Building Blocks;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;Aromatic Acetophenones & Derivatives (substituted);C10;Carbonyl Compounds;Ketones | | Mol File: | 90-24-4.mol |  |
| | 2'-Hydroxy-4',6'-dimethoxyacetophenone Chemical Properties |
| Melting point | 80-84 °C(lit.) | | Boiling point | 185°C/20mm | | density | 1.172±0.06 g/cm3(Predicted) | | Fp | 185°C/20mm | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Soluble in hot methanol. | | pka | 9.41±0.15(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | Merck | 14,10067 | | BRN | 1285013 | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | InChI | 1S/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 | | InChIKey | FBUBVLUPUDBFME-UHFFFAOYSA-N | | SMILES | COc1cc(O)c(C(C)=O)c(OC)c1 | | LogP | 2.933 (est) | | CAS DataBase Reference | 90-24-4(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids |
| | 2'-Hydroxy-4',6'-dimethoxyacetophenone Usage And Synthesis |
| Uses | 2'-Hydroxy-4',6'-dimethoxyacetophenone is a chemical with potential antibacterial agent effects and urease inhibitory effects as well as synthesis applications. | | Uses | 1-(2-Hydroxy-4,6-dimethylphenyl)-ethanone was investigated for its properties as an antibacterial agent and urease inhibitory effects. | | Preparation | Preparation by reaction of acetonitrile on phloroglucinol dimethyl ether (Hoesch reaction). | | Definition | ChEBI: Xanthoxylin is a carboxylic ester. It is functionally related to a phloroglucinol. | | Synthesis | Prod.: by regulated (Di)methylation of Phloracetophenone with Dimethylsulfate in weak aqueous alkali. | | References | [1] Bulletin of the Korean Chemical Society, 2013, vol. 34, # 12, p. 3782 - 3786 [2] Patent: WO2010/19861, 2010, A1. Location in patent: Page/Page column 38; 50 [3] Patent: EP2112145, 2009, A1. Location in patent: Page/Page column 14-15 [4] Bulletin of the Korean Chemical Society, 2014, vol. 35, # 4, p. 1154 - 1158 [5] Patent: KR2015/49695, 2015, A. Location in patent: Paragraph 0063-0072 |
| | 2'-Hydroxy-4',6'-dimethoxyacetophenone Preparation Products And Raw materials |
| Raw materials | 3,5-Dimethoxyphenol acetate-->2',4',6'-Trimethoxyacetophenone-->2',4',6'-Trihydroxyacetophenone monohydrate-->3,5-Dimethoxyphenol-->Acetyl chloride-->Iodomethane-->Dimethyl sulfate-->Dimethyl carbonate-->Acetic acid-->Acetone | | Preparation Products | 2-Hydroxy-3-iodo-4,6-dimethoxy acetophenone-->Robustaflavone-->Scutellarein 4',7- dimethyl ether-->2',4',6'-Trimethoxyacetophenone-->Isolicoflavonol-->5,7-Dimethoxyflavone-->Pinostrobin-->aciculatin-->5,7-Dimethoxyisoflavone |
|