|
|
| | 2-Methoxyethyl methacrylate Basic information |
| Product Name: | 2-Methoxyethyl methacrylate | | Synonyms: | 2-METHOXYETHYL METHACRYLATE;2-methyl-2-propenoicaci2-methoxyethylester;2-Propenoicacid,2-methyl-,2-methoxyethylester;Ethylene glycol methyl ether methacrylate~Methacrylic acid 2-methoxyethyl ether;Methoxyethyl Methacrylate;Methacrylic acid (3-oxabutan-1-yl) ester;Methacrylic acid 2-methoxyethyl ester;Methacrylic acid 3-oxabutane-1-yl ester | | CAS: | 6976-93-8 | | MF: | C7H12O3 | | MW: | 144.17 | | EINECS: | 230-241-9 | | Product Categories: | | | Mol File: | 6976-93-8.mol |  |
| | 2-Methoxyethyl methacrylate Chemical Properties |
| Boiling point | 65 °C12 mm Hg(lit.) | | density | 0.993 g/mL at 25 °C(lit.) | | vapor pressure | 22.3Pa at 20℃ | | refractive index | n20/D 1.431(lit.) | | Fp | 150 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | 31.33g/L at 20℃ | | InChI | InChI=1S/C7H12O3/c1-6(2)7(8)10-5-4-9-3/h1,4-5H2,2-3H3 | | InChIKey | YXYJVFYWCLAXHO-UHFFFAOYSA-N | | SMILES | C(OCCOC)(=O)C(C)=C | | LogP | 1.3 at 23.3℃ | | CAS DataBase Reference | 6976-93-8(CAS DataBase Reference) | | EPA Substance Registry System | 2-Methoxyethyl methacrylate (6976-93-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29161400 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | 2-Methoxyethyl methacrylate Usage And Synthesis |
| Uses | Used in the synthesis of copolymers of styrene and 2-methoxyethyl methacrylate. | | Definition | ChEBI: Poly(ethylene glycol) methyl ether methacrylate is a poly(ethylene glycol) compound having a methacrylate group at the alpha-terminus and a methyl group at the omega-terminus. | | Application | 2-Methoxyethyl methacrylate is a monomer that can be used to prepare poly(2-methoxyethyl methacrylate) (PMEMA) polymers.When PMEMA polymers undergo thermal decomposition at temperatures up to 500°C, two different reactions occur. The primary reaction is depolymerisation, where the only product is the monomer. The secondary reaction is esterolysis, which produces very small amounts of volatile products including carbon monoxide, carbon dioxide, methane, ethylene, isobutylene, methyl vinyl ether, methanol and formaldehyde. | | General Description | Polymers prepared from this monomer may have uses in polyelectrolytes and may be biocompatible. | | Flammability and Explosibility | Non flammable |
| | 2-Methoxyethyl methacrylate Preparation Products And Raw materials |
|