| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (+)-NOE'S REAGENT Basic information |
| Product Name: | (+)-NOE'S REAGENT | | Synonyms: | (2R,3AS,4R,7AS)-OCTAHYDRO-7,8,8-TRIMETHYL-4,7-METHANOBENZOFURAN-2-YL ETHER;(+)-MBF-OH DIMER;BIS[(2R,3AS,4R,7AS)-OCTAHYDRO-7,8,8-TRIMETHYL-4,7-METHANOBENZOFURAN-2-YL] ETHER;(+)-NOE-LACTOL(R) DIMER;(+)-NOE'S REAGENT;(+)-NOE-LACTOL DIMER, 99+%;BIS[(2R,3AS,4R,7AS)-OCTAHYDRO-7,8,8-TRIMETHYL-4,7-METHANOBENZOFURAN-2-YL] ETHER [FOR OPTICAL RESOLUTION] 98+%;Bis[(2R,3aS,4R,7aS)-octahydro-7,8,8-trimethyl-4,7-methanobenzofuran-2-yl] Ether [for Optical Resolution] | | CAS: | 87248-50-8 | | MF: | C24H38O3 | | MW: | 374.56 | | EINECS: | | | Product Categories: | for Resolution of Alcohols & Thiols;Optical Resolution;Synthetic Organic Chemistry | | Mol File: | 87248-50-8.mol |  |
| | (+)-NOE'S REAGENT Chemical Properties |
| Melting point | 149-151 °C | | Boiling point | 435.9±30.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | refractive index | 202.5 ° (C=2, THF) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]21/D +199.1°, c = 2.25 in THF | | InChIKey | VUDXCBLBKXFCNA-VFQSMPPFSA-N | | SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H]3O[C@@H](C[C@@H]23)O[C@@H]4C[C@H]5[C@H]6CC[C@@](C)([C@H]5O4)C6(C)C | | CAS DataBase Reference | 87248-50-8 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2932.99.9090 | | Storage Class | 13 - Non Combustible Solids |
| | (+)-NOE'S REAGENT Usage And Synthesis |
| Uses | (+)-Noe-lactol dimer can be used to prepare:
- Axially chiral isoquinoline derivatives by reacting with pyridiniump-toluenesulfonate.
- Halofuginone lactate.
|
| | (+)-NOE'S REAGENT Preparation Products And Raw materials |
|