|
|
| | (S)-N-Cbz-azetidine-2-carboxylic acid Basic information |
| Product Name: | (S)-N-Cbz-azetidine-2-carboxylic acid | | Synonyms: | (S)-1-Cbz-2-azetidinecarboxylic acid;N-Cbz-S-2-Azetidinecarboxylic acid;(2S)-1-phenylmethoxycarbonylazetidine-2-carboxylic acid;Z-Aze-OH;(2S)-1-[(benzyloxy)carbonyl]azetidine-2-carboxylic acid;1,2-Azetidinedicarboxylic acid, 1-(phenylmethyl) ester, (2S)-;RMA-396;(S)-1-Cbz-azetidine-2-carboxylic acid | | CAS: | 25654-52-8 | | MF: | C12H13NO4 | | MW: | 235.24 | | EINECS: | | | Product Categories: | | | Mol File: | 25654-52-8.mol |  |
| | (S)-N-Cbz-azetidine-2-carboxylic acid Chemical Properties |
| Boiling point | 421.2±45.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 3.99±0.20(Predicted) | | Appearance | white to off-white solid | | InChI | InChI=1S/C12H13NO4/c14-11(15)10-6-7-13(10)12(16)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15)/t10-/m0/s1 | | InChIKey | IUWBMOQXJOJWBF-JTQLQIEISA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)CC[C@H]1C(O)=O |
| | (S)-N-Cbz-azetidine-2-carboxylic acid Usage And Synthesis |
| Uses | (S)-1-((Benzyloxy)carbonyl)azetidine-2-carboxylic Acid is an intermediate for the synthesis of Mugineic Acid Ammonium Salt (M792005). Mugineic Acid, a possible phytosiderophore of graminaceous plants, has iron chelation potency and antioxidant activity. |
| | (S)-N-Cbz-azetidine-2-carboxylic acid Preparation Products And Raw materials |
|