| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Diisopropyl Allylboronate Basic information |
| Product Name: | Diisopropyl Allylboronate | | Synonyms: | Diisopropyl Allylboronate;DiisopropylAllylboronate>;Boronic acid, B-2-propen-1-yl-, bis(1-methylethyl) ester;dipropan-2-yl prop-2-en-1-ylboronate | | CAS: | 51851-79-7 | | MF: | C9H19BO2 | | MW: | 170.06 | | EINECS: | | | Product Categories: | | | Mol File: | 51851-79-7.mol |  |
| | Diisopropyl Allylboronate Chemical Properties |
| Boiling point | 74-76 °C(Press: 15 Torr) | | density | 0.819±0.06 g/cm3(Predicted) | | refractive index | 1.4000-1.4040 | | storage temp. | 0-10°C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C9H19BO2/c1-6-7-10(11-8(2)3)12-9(4)5/h6,8-9H,1,7H2,2-5H3 | | InChIKey | LWPLTONTMJTRJL-UHFFFAOYSA-N | | SMILES | B(CC=C)(OC(C)C)OC(C)C | | CAS DataBase Reference | 51851-79-7 |
| RIDADR | 1993 | | HS Code | 2931.90.9051 | | HazardClass | 3 | | PackingGroup | III |
| | Diisopropyl Allylboronate Usage And Synthesis |
| | Diisopropyl Allylboronate Preparation Products And Raw materials |
|