| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Fmoc-Asp(OtBu)-OH (U-13C4, 15N) Basic information |
| | Fmoc-Asp(OtBu)-OH (U-13C4, 15N) Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | Major Application | peptide synthesis | | InChIKey | FODJWPHPWBKDON-YHPYBGJVSA-N | | SMILES | CC(C)(C)O[13C](=O)[13CH2][13C@@H]([15NH]C(=O)OCC1c2ccccc2-c3ccccc13)[13C](O)=O |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Asp(OtBu)-OH (U-13C4, 15N) Usage And Synthesis |
| | Fmoc-Asp(OtBu)-OH (U-13C4, 15N) Preparation Products And Raw materials |
|