| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
|
| | L-Arginine-13C6,15N4 Na-Fmoc-Nw-Pbf derivative Basic information |
| Product Name: | L-Arginine-13C6,15N4 Na-Fmoc-Nw-Pbf derivative | | Synonyms: | L-Arginine-13C6,15N4 Na-Fmoc-Nw-Pbf derivative;L-Arginine-13C6,15N4-N-FMOC, PBF-OH;Fmoc-Arg(Pbf)-OH-13C6,15N4;"L-Arginine (Pbf)-OH-13C6,15N4, -Fmoc";L-ARGININE-N-FMOC, PBF-OH (13C6, 99%;Fmoc-Arg(Pbf)-OH-13C6,15N4;1?N?, 99%) contains solvent;L-Arginine-??-Fmoc, pbf-OH (13C?, 99% | | CAS: | 1217461-89-6 | | MF: | C34H40N4O7S | | MW: | 658.859 | | EINECS: | | | Product Categories: | | | Mol File: | 1217461-89-6.mol |  |
| | L-Arginine-13C6,15N4 Na-Fmoc-Nw-Pbf derivative Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | Major Application | peptide synthesis | | InChIKey | HNICLNKVURBTKV-NJBLHHMJSA-N | | SMILES | Cc1c(C)c(c(C)c2CC(C)(C)Oc12)S(=O)(=O)[15NH][13C](=[15NH])[15NH][13CH2][13CH2][13CH2][13C@H]([15NH]C(=O)OCC3c4ccccc4-c5ccccc35)[13C](O)=O | | CAS Number Unlabeled | 154445-77-9 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Arginine-13C6,15N4 Na-Fmoc-Nw-Pbf derivative Usage And Synthesis |
| Uses | Fmoc-Arg(Pbf)-OH (U-13C6, U-15N4) is a reagent in the preparation of mannose-binding lectin (MBL)-associated serine protease (MASP) inhibitory peptides and cyclic peptides. |
| | L-Arginine-13C6,15N4 Na-Fmoc-Nw-Pbf derivative Preparation Products And Raw materials |
|