| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Fmoc-Ser(tBu)-OH-13C3,15N Basic information |
| | Fmoc-Ser(tBu)-OH-13C3,15N Chemical Properties |
| Melting point | 131-136 °C | | density | 1.217±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | form | solid | | Major Application | peptide synthesis | | InChIKey | REITVGIIZHFVGU-FIEXIFIBSA-N | | SMILES | CC(C)(C)O[13CH2][13C@H]([15NH]C(=O)OCC1c2ccccc2-c3ccccc13)[13C](O)=O | | CAS Number Unlabeled | 71989-33-8 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Ser(tBu)-OH-13C3,15N Usage And Synthesis |
| | Fmoc-Ser(tBu)-OH-13C3,15N Preparation Products And Raw materials |
|