|
|
| | 4-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Basic information |
| | 4-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Chemical Properties |
| form | solid | | InChI | 1S/C8H4F3IN2/c9-8(10,11)5-3-14-7-4(6(5)12)1-2-13-7/h1-3H,(H,13,14) | | InChIKey | GYRRXQBOUNXNLU-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cnc2[nH]ccc2c1I |
| Hazard Codes | T | | Risk Statements | 25-36 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 4-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Usage And Synthesis |
| | 4-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Preparation Products And Raw materials |
|