4-PROPOXYANILINE manufacturers
- 4-PROPOXYANILINE
-
- $1.10 / 1g
-
2025-11-18
- CAS:4469-80-1
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- 4-PROPOXYANILINE
-
- $1.00 / 1KG
-
2019-09-02
- CAS:4469-80-1
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 200KG
|
| | 4-PROPOXYANILINE Basic information |
| | 4-PROPOXYANILINE Chemical Properties |
| Melting point | 265-267℃ | | Boiling point | 261.7±13.0℃ (760 Torr) | | density | 1.016±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | >230 °F | | solubility | Slightly soluble (1.3 g/L at 25°C). | | pka | 5.24±0.10(Predicted) | | form | Liquid | | color | Brown | | InChI | InChI=1S/C9H13NO/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6H,2,7,10H2,1H3 | | InChIKey | DWOIGSLSPPLRKO-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(OCCC)C=C1 | | CAS DataBase Reference | 4469-80-1 | | EPA Substance Registry System | Benzenamine, 4-propoxy- (4469-80-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2922290090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-PROPOXYANILINE Usage And Synthesis |
| Uses | 4-n-Propoxyaniline is used as a reactant for preparation of aggrecanase inhibitors. |
| | 4-PROPOXYANILINE Preparation Products And Raw materials |
|