- Eosin B
-
- $0.00 / 1KG
-
2026-05-27
- CAS:548-24-3
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- Acid Red
-
- $350.00 / 100g
-
2024-02-18
- CAS:548-24-3
- Min. Order: 1g
- Purity: 98
- Supply Ability: 500 Kg
- Eosine I Bluish
-
- $1.00 / 1KG
-
2019-07-10
- CAS:548-24-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 25kg
|
| | EOSIN B Basic information |
| Product Name: | EOSIN B | | Synonyms: | C.I. Acid Red 91;Eosin B, high purity biological stain;Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 4',5'-dibromo-3',6'-dihydroxy-2',7'-dinitro-, disodium salt;2-(4,5-dibromo-3,6-dihydroxy-2,7-dinitroxanthen-9-yl)-benzoic acid, disodium salt;EOSIN B CERTIFIED;EOSIN B CERTIFIED (C.I. 45400);EOSIN SCARLET, FOR MICROSCOPY;EOSIN BLUISH, WATER-SOLUBLE, PURE, FOR M ICROSCOPY | | CAS: | 548-24-3 | | MF: | C20H9Br2N2NaO9 | | MW: | 604.09 | | EINECS: | 208-943-1 | | Product Categories: | Organics;Xanthene | | Mol File: | 548-24-3.mol |  |
| | EOSIN B Chemical Properties |
| Melting point | 275 °C (dec.)(lit.) | | bulk density | 680kg/m3 | | storage temp. | Store at +5°C to +30°C. | | solubility | spirit: soluble | | Colour Index | 45400 | | form | Solid | | color | Very dark purple-red to dark brown | | PH | 6.2 (10g/l, H2O, 25℃) | | Water Solubility | Soluble in water (390 g/L at 20°C), and ethanol. | | λmax | 514 nm, 395 nm | | Merck | 14,3602 | | BRN | 4121964 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Biological Applications | Antimalarial agent; protein assay; detecting enzyme activity; treating cancer,malaria,diabetes,a variety of conditions affecting skin,mouth,digestive tract,urinary tract,reproductive tract,respiratory tract,circulatory sys | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C20H8Br2N2O9.2Na/c21-14-16(25)11(23(29)30)5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(24(31)32)17(26)15(22)19(10)33-18(9)14;;/h1-6,25H,(H,27,28);;/q;2*+1/p-2 | | InChIKey | GYYTYUGGVBYJHE-UHFFFAOYSA-L | | SMILES | [Na+].[Na+].[O-]C(=O)c1ccccc1C2=C3C=C(C(=O)C(Br)=C3Oc4c(Br)c([O-])c(cc24)[N+]([O-])=O)[N+]([O-])=O | | EPA Substance Registry System | Eosin B (548-24-3) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 3204 12 00 | | Storage Class | 11 - Combustible Solids |
| | EOSIN B Usage And Synthesis |
| Chemical Properties | odourless green to reddish-brown solid | | Uses | Dyeing wool, cotton, and paper. In histology as a stain for epithelia, muscular fibers, nuclei, etc. | | Uses | Eosin B sodium salt is a cell and tissue stain. Eosin B sodium salt is used as a counter stain for collagen, as a tissue stain for cell granules, nuclei, and microorganisms when coupled with Azure A (sc-203729), and as a stain for cell differentiation of the anterior pituitary. | | Preparation | will 4′,5′-Dibromofluorescein(C.I. Acid Orange 11, C.I. 45370) nitrification, and translated into sodium salt or ammonium salt. | | Definition | ChEBI: An organic sodium salt which is the disodium salt of eosin b diphenol. | | Biological Activity | Eosin B is a xanthene dye and is also referred to as eosin bluish or erythrosin B. It is used in the Harris stain for Negri bodies. Eosin B is also used in Mayer′s Hemalum as a counterstain for collagen. Eosin B-Azure A are used together for the staining of cell granules, nuclei and microorganisms. It can also be used for protein estimation. The protein - eosin B complex absorbs at wavelength range of 536–544nm and the change in blue shift helps in determining the protein concentration. | | storage | Room temperature | | Purification Methods | Free it from inorganic halides by repeated crystallisation from butan-1-ol. [Beilstein 19/6 V 469.] | | Properties and Applications | colourful red blue light.
|
Standard
|
Light Fastness
|
Soaping
|
Persperation Fastness
|
Oxygen bleaching
|
Fastness to seawater
|
|
Fading
|
Stain
|
Fading
|
Stain
|
Fading
|
Stain
|
|
ISO
|
3
|
3
|
|
3
|
3
|
|
3
|
|
|
| | EOSIN B Preparation Products And Raw materials |
|