|
|
| | p-Nitrophenyl 2-acetamido-2-deoxy-alpha-D-glucopyranoside Basic information |
| | p-Nitrophenyl 2-acetamido-2-deoxy-alpha-D-glucopyranoside Chemical Properties |
| Melting point | 264 °C | | Boiling point | 477.77°C (rough estimate) | | density | 1.3038 (rough estimate) | | refractive index | 1.5110 (estimate) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly, heated) | | pka | 12.76±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C14H18N2O8/c1-7(18)15-11-13(20)12(19)10(6-17)24-14(11)23-9-4-2-8(3-5-9)16(21)22/h2-5,10-14,17,19-20H,6H2,1H3,(H,15,18)/t10-,11-,12-,13-,14+/m1/s1 | | InChIKey | OMRLTNCLYHKQCK-KSTCHIGDSA-N | | SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1Oc2ccc(cc2)[N+]([O-])=O | | CAS DataBase Reference | 10139-02-3(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | p-Nitrophenyl 2-acetamido-2-deoxy-alpha-D-glucopyranoside Usage And Synthesis |
| Chemical Properties | P-NITROPHENYL 2-ACETAMIDO-2-DEOXY-ALPHA-D-GLUCOPYRANOSIDE is White Solid | | Uses | P-NITROPHENYL 2-ACETAMIDO-2-DEOXY-ALPHA-D-GLUCOPYRANOSIDE is a useful substrate for assays of N-acetyl-alpha-galactosaminidase used in detection of Sanfilippo syndrome B | | Uses | substrate for b-L-fucosidases | | Uses | A useful substrate for assays of N-acetyl-alpha-galactosaminidase used in detection of Sanfilippo syndrome B. | | Definition | ChEBI: An N-acetyl-alpha-D-glucosaminide in which the anomeric hydroxy hydrogen is replaced by a 4-nitrophenyl group. | | Biochem/physiol Actions | 4-Nitrophenyl N-acetyl-α-D-glucosaminide is used as a substrate for analysing β-hexoaminidase activity at 37°C and analysed at 405 nm. |
| | p-Nitrophenyl 2-acetamido-2-deoxy-alpha-D-glucopyranoside Preparation Products And Raw materials |
|