| Company Name: |
Rushpharm Co.,Ltd. Gold |
| Tel: |
025-66042949 15161141411 |
| Email: |
2244332520@qq.com |
|
| | 1,4'-Bipiperidine dihydrochloride Basic information |
| Product Name: | 1,4'-Bipiperidine dihydrochloride | | Synonyms: | 4-(1-PIPERIDINYL)PIPERIDINE 2HCL;4-(1-PIPERIDINYL)PIPERIDINE DIHYDROCHLORIDE;4-(PIPERIDINE)PIPERIDINE HYDROCHLORIDE;1-(PIPERDIN-4-YL)PIPERIDINE DIHYDROCHLORIDE;1-(PIPERIDIN-4-YL)PIPERIDINE DIHYDROCHLORIDE;[1,4']BIPIPERIDINYL DIHYDROCHLORIDE;[1,4']Bipiperidinyl 2HCl;1,4'-Bipiperidine, hydrochloride (1:2) | | CAS: | 4876-60-2 | | MF: | C10H22Cl2N2 | | MW: | 241.2 | | EINECS: | 225-487-9 | | Product Categories: | Piperidine;Piperidine Series | | Mol File: | 4876-60-2.mol |  |
| | 1,4'-Bipiperidine dihydrochloride Chemical Properties |
| InChI | InChI=1S/C10H20N2.2ClH/c1-2-8-12(9-3-1)10-4-6-11-7-5-10;;/h10-11H,1-9H2;2*1H | | InChIKey | BBQDEKNMSAXDAK-UHFFFAOYSA-N | | SMILES | N1(C2CCNCC2)CCCCC1.[H]Cl.[H]Cl | | CAS DataBase Reference | 4876-60-2(CAS DataBase Reference) |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 1,4'-Bipiperidine dihydrochloride Usage And Synthesis |
| Description | 1,4'-Bipiperidine dihydrochloride is an impurity related to Irinotecan, a chemotherapy medication used to treat tumor. |
| | 1,4'-Bipiperidine dihydrochloride Preparation Products And Raw materials |
|