| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- Biotin-PEG3-COOH
-
-
2025-06-07
- CAS:252881-76-8
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Biotin-PEG3-propionic acid Basic information |
| Product Name: | Biotin-PEG3-propionic acid | | Synonyms: | Biotin-PEG3-propionic acid;18-[(3aS,4S,6aR)-Hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-14-oxo-4,7,10-trioxa-13-azaoctadecanoic acid;(+)-Biotin-PEG3-CH2CH2COOH;(+)-Biotin-PEG3-propionic acid;(+)-BIOTIN-PEG3-PROPIONIC ACID;4,7,10-Trioxa-13-azaoctadecanoic acid, 18-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-14-oxo-;(+)-Biotin-PEG3-acid;(+)-Biotin-PEG?-propionic acid | | CAS: | 252881-76-8 | | MF: | C19H33N3O7S | | MW: | 447.55 | | EINECS: | | | Product Categories: | peg;SiChem | | Mol File: | 252881-76-8.mol |  |
| | Biotin-PEG3-propionic acid Chemical Properties |
| Boiling point | 770.7±60.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | solubility | Soluble in Water, DMSO, DMF | | pka | 4.28±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | HRGPPBXEZFBGDJ-MPGHIAIKSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1 |
| | Biotin-PEG3-propionic acid Usage And Synthesis |
| Description | Biotin-PEG3-acid is a biotinylation reagent that can react with amine attached molecule. PEG attached to the biotin gives an extended spacer arm that permits the biotin to reach into the binding pocket of the protein or macromolecule. | | Uses | Biotin-PEG3-acid is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs | | References | [1] Gadd MS, et al. Structural basis of PROTAC cooperative recognition for selective protein degradation. Nat Chem Biol. 2017 May;13(5):514-521. DOI:10.1038/nchembio.2329 |
| | Biotin-PEG3-propionic acid Preparation Products And Raw materials |
|