|
|
| | Fmoc-NH-PEG3-CH2COOH Basic information |
| Product Name: | Fmoc-NH-PEG3-CH2COOH | | Synonyms: | Fmoc-3-(2-(2-aminoethoxy)ethoxy)propanoic acid;FMoc-11-aMino-3,6,9-trioxaundexanoic acid;FMoc-11-aMino-3,6,9-trioxaundecanoic acid;FMoc-NH-PEG3-CH2COOH;5,8,11-Trioxa-2-azatridecanedioic acid 1-(9H-fluoren-9-ylmethyl) ester;Fmoc-PEG3- CH2COOH;Fmoc-NH-PEG3-CH2CO2H;N-Fmoc-11-amino-3,6,9-trioxaundecanoic acid | | CAS: | 139338-72-0 | | MF: | C23H27NO7 | | MW: | 429.46 | | EINECS: | | | Product Categories: | peg | | Mol File: | 139338-72-0.mol |  |
| | Fmoc-NH-PEG3-CH2COOH Chemical Properties |
| Melting point | 46℃ | | Boiling point | 658.9±50.0 °C(Predicted) | | density | 1.248±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO | | form | Liquid | | pka | 3.39±0.10(Predicted) | | color | Colorless to light yellow | | InChI | InChI=1S/C23H27NO7/c25-22(26)16-30-14-13-29-12-11-28-10-9-24-23(27)31-15-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-8,21H,9-16H2,(H,24,27)(H,25,26) | | InChIKey | XNOJSAOJCBOZTA-UHFFFAOYSA-N | | SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)NCCOCCOCCOCC(O)=O |
| | Fmoc-NH-PEG3-CH2COOH Usage And Synthesis |
| Description | Fmoc-NH-PEG3-CH2COOH is a PEG linker containing an Fmoc-protected amine and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | Fmoc-NH-PEG3-CH2COOH Appearance is colourless to light yellow viscous liquid, stored at -20℃. | | Uses | Fmoc-9-amino-4,7-dioxanonanoic acid is an amino acid derivative and can be used as a pharmaceutical intermediate. | | IC 50 | PEGs; Alkyl/ether |
| | Fmoc-NH-PEG3-CH2COOH Preparation Products And Raw materials |
|