|
|
| | Metaraminol Enantiomer (25 mg) (3-[(1S,2R)-2-Amino-1-hydroxypropyl]phenol D-tartrate) Basic information |
| Product Name: | Metaraminol Enantiomer (25 mg) (3-[(1S,2R)-2-Amino-1-hydroxypropyl]phenol D-tartrate) | | Synonyms: | Metaraminol Enantiomer;Metaraminol Enantiomer (25 mg) (3-[(1S,2R)-2-Amino-1-hydroxypropyl]phenol D-tartrate);Metaraminol Bitartrate Impurity 2(Metaraminol Bitartrate Enantiomer);Metaraminol bitartrate enantiomer;Metaraminol EnantiomerQ: What is
Metaraminol Enantiomer Q: What is the CAS Number of
Metaraminol Enantiomer;Metaraminol Impurity 2(L-(+)-Tartaric Acid);Metaraminol Bitartrate Enantiomer C;Isobutanol tartrate enantiomer | | CAS: | 27303-40-8 | | MF: | C13H19NO8 | | MW: | 317.29 | | EINECS: | | | Product Categories: | | | Mol File: | 27303-40-8.mol | ![Metaraminol Enantiomer (25 mg) (3-[(1S,2R)-2-Amino-1-hydroxypropyl]phenol D-tartrate) Structure](CAS/20210111/GIF/27303-40-8.gif) |
| | Metaraminol Enantiomer (25 mg) (3-[(1S,2R)-2-Amino-1-hydroxypropyl]phenol D-tartrate) Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | Major Application | pharmaceutical | | InChI | InChI=1/C9H13NO2.C4H6O6/c1-6(10)9(12)7-3-2-4-8(11)5-7;5-1(3(7)8)2(6)4(9)10/h2-6,9,11-12H,10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t6-,9-;1-,2-/s3 | | InChIKey | VENXSELNXQXCNT-QLPKXVKANA-N | | SMILES | [C@@H](C1C=CC=C(O)C=1)(O)[C@H](N)C.[C@@H](O)(C(=O)O)[C@H](O)C(=O)O |&1:0,9,12,17,r| |
| WGK Germany | WGK 3 | | HS Code | 2939800000 | | Storage Class | 11 - Combustible Solids |
| | Metaraminol Enantiomer (25 mg) (3-[(1S,2R)-2-Amino-1-hydroxypropyl]phenol D-tartrate) Usage And Synthesis |
| Uses | Metaraminol Bitartrate Enantiomer is a related compound of Metaraminol Bitartrate(M225565). Metaraminol Bitartrate is a vasopressor comparable to ephedrine used in the maintenance of arterial pressure during spinal anesthesia. Also used in the treatment of hypotension while under the effect of anaesthesia. |
| | Metaraminol Enantiomer (25 mg) (3-[(1S,2R)-2-Amino-1-hydroxypropyl]phenol D-tartrate) Preparation Products And Raw materials |
|