- 3-phenyl-9H-carbazole
-
-
2026-08-18
- CAS:103012-26-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 150KG /month
- 3-Phenyl-9H-carbazole
-
- $5.00
-
2026-05-28
- CAS:103012-26-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | 3-phenyl-9H-carbazole Basic information | | Uses |
| Product Name: | 3-phenyl-9H-carbazole | | Synonyms: | 3-phenyl-9H-carbazole;-phenyl-9H-carbazole;3-Phenyl carbazole;3-phenyl-9H-carabazole;9H-Carbazole, 3-phenyl-;3-phenyl-9H-carbazole ISO 9001：2015 REACH;3-phenyl-9H-carbazole 103012-26-6 high purity 3-phenyl-9H-carbazole;dichlororuthenium(II) | | CAS: | 103012-26-6 | | MF: | C18H13N | | MW: | 243.3 | | EINECS: | | | Product Categories: | | | Mol File: | 103012-26-6.mol |  |
| | 3-phenyl-9H-carbazole Chemical Properties |
| Melting point | 222.8-224.1℃ | | Boiling point | 474.3±14.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 16.97±0.30(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C18H13N/c1-2-6-13(7-3-1)14-10-11-18-16(12-14)15-8-4-5-9-17(15)19-18/h1-12,19H | | InChIKey | IAWRFMPNMXEJCK-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=C1C=CC(C1=CC=CC=C1)=C2 | | CAS DataBase Reference | 103012-26-6 |
| | 3-phenyl-9H-carbazole Usage And Synthesis |
| Uses | 3-Phenyl-9H-carbazole is a useful research chemical. | | Chemical Properties | off-white powder |
| | 3-phenyl-9H-carbazole Preparation Products And Raw materials |
|