| Company Name: |
Baynoe Chem Co.,LTD Gold |
| Tel: |
+86-021-34783353 15000719740 |
| Email: |
baynoe@baynoe.com |
- 2-chloroarbazole
-
- $188.00
-
2026-09-02
- CAS:10537-08-3
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
|
| | 2-chloro-9H-carbazole Basic information | | Uses |
| Product Name: | 2-chloro-9H-carbazole | | Synonyms: | 2-chloroarbazole;2-chloro-9H-carbazole;2-Chloro-9H-carbazole;9H-Carbazole, 2-chloro-;2-chloro-9H-carbazole ISO 9001：2015 REACH;TIANFU-CHEM 2-chloro-9H-carbazole;2-Chlorocarbazole | | CAS: | 10537-08-3 | | MF: | C12H8ClN | | MW: | 201.65 | | EINECS: | | | Product Categories: | | | Mol File: | 10537-08-3.mol |  |
| | 2-chloro-9H-carbazole Chemical Properties |
| Melting point | 244℃ | | Boiling point | 388.7±15.0 °C(Predicted) | | density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 16.21±0.30(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C12H8ClN/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7,14H | | InChIKey | LOQQFCPPDBFFSO-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=C1C=C(Cl)C=C2 |
| | 2-chloro-9H-carbazole Usage And Synthesis |
| Uses | 2-Chloro-9H-carbazole is a useful research chemical. | | Chemical Properties |
2-chloro-9H-carbazole is a solid, it reacets with strong oxidizing agents.
| | Application | 2-Chloro-9H-carbazole exhibits unique electronic properties, making it an excellent candidate for use in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). | | Health Hazard |
2-chloro-9H-carbazole can causes eye, skin, and respiratory tract irritation.
|
| | 2-chloro-9H-carbazole Preparation Products And Raw materials |
|