Ganoderic acid C6 manufacturers
- Ganoderic acid C6
-
- $68.00
-
2026-07-15
- CAS:105742-76-5
- Purity: 99.98%
- Supply Ability: 10g
- Ganoderic acid C6
-
-
2023-02-24
- CAS:105742-76-5
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Ganoderic Acid C6
-
- $9.80
-
2020-01-10
- CAS:105742-76-5
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | Ganoderic acid C6 Basic information |
| Product Name: | Ganoderic acid C6 | | Synonyms: | Ganoderic acid C6;(3beta,12beta)-3,12-Dihydroxy-7,11,15,23-tetraoxo-lanost-8-en-26-oic acid;12-Deacetylganoderic acid H;Lanost-8-en-26-oic acid, 3,12-dihydroxy-7,11,15,23-tetraoxo-, (3β,12β)-;(6R)-6-((3S,5R,10S,12S,13R,14R,17R)-3,12-dihydroxy-4,4,10,13,14-pentamethyl-7,11,15-trioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxoheptanoic acid;Pantoprazole Impurity 7 Sodium Salt | | CAS: | 105742-76-5 | | MF: | C30H42O8 | | MW: | 530.65 | | EINECS: | | | Product Categories: | | | Mol File: | 105742-76-5.mol |  |
| | Ganoderic acid C6 Chemical Properties |
| Melting point | 208-210 °C | | Boiling point | 708.3±60.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 4.77±0.23(Predicted) | | color | White to off-white | | InChIKey | BTYTWXWAFWKSTA-XTXUUAGGNA-N | | SMILES | C[C@@]12C(C[C@]([H])([C@H](C)CC(=O)CC(C)C(=O)O)[C@]1([C@H](O)C(=O)C1[C@]3(CC[C@H](O)C(C)(C)[C@]3([H])CC(=O)C2=1)C)C)=O |&1:1,4,6,17,18,23,26,31,r| |
| | Ganoderic acid C6 Usage And Synthesis |
| Chemical Properties | Yellow flocculent crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, are derived from the dried fruiting bodies of Ganoderma lucidum (Leyss. exFr.) Karst., a Polyporaceae fungus. | | Uses | Ganoderic acid C6 has aldose reductase inhibitory activity[1]. | | References | [1] Fatmawati S, Shimizu K, Kondo R. Structure-activity relationships of ganoderma acids from Ganoderma lucidum as aldose reductase inhibitors.Bioorg Med Chem Lett. 2011;21(24):7295-7297. DOI:10.1016/j.bmcl.2011.10.035 |
| | Ganoderic acid C6 Preparation Products And Raw materials |
|